2-Bromo-6-chlorobenzoic acid
Catalog No: FT-0600975
CAS No: 93224-85-2
- Chemical Name: 2-Bromo-6-chlorobenzoic acid
- Molecular Formula: C7H4BrClO2
- Molecular Weight: 235.46 g/mol
- InChI Key: URGXUQODOUMRFP-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4BrClO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 235.462 |
|---|---|
| CAS: | 93224-85-2 |
| Flash_Point: | 144.8±23.7 °C |
| MF: | C7H4BrClO2 |
| Symbol: | Danger |
| Bolling_Point: | 315.9±27.0 °C at 760 mmHg |
| Melting_Point: | 148-150ºC |
| Product_Name: | 2-Bromo-6-chlorobenzoic acid |
| Density: | 1.8±0.1 g/cm3 |
| FW: | 235.462 |
|---|---|
| MF: | C7H4BrClO2 |
| Exact_Mass: | 233.908310 |
| Flash_Point: | 144.8±23.7 °C |
| LogP: | 2.24 |
| PSA: | 37.30000 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Bolling_Point: | 315.9±27.0 °C at 760 mmHg |
| Melting_Point: | 148-150ºC |
| Density: | 1.8±0.1 g/cm3 |
| Refractive_Index: | 1.621 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| Symbol: | GHS06 |
| Warning_Statement: | P261-P301 + P310-P305 + P351 + P338 |
| RIDADR: | UN 2811 6.1 / PGIII |
| Hazard_Codes: | Xi: Irritant; |
| Safety_Statements: | H301-H315-H319-H335 |
| HS_Code: | 2916399090 |
Related Products
(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid;hydrochloride
Carbonic dichloride,polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol